CAS 36155-75-6
:Boronic acid, (3-acetyl-2-thienyl)-
Description:
Boronic acid, (3-acetyl-2-thienyl)-, identified by CAS number 36155-75-6, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thienyl ring with an acetyl substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The thienyl moiety contributes to its aromatic character and may influence its reactivity and solubility. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic chemistry. Additionally, the acetyl group can enhance the compound's stability and solubility in organic solvents. Overall, this compound's unique structure allows it to participate in diverse chemical reactions, making it valuable in synthetic organic chemistry and potentially in medicinal chemistry for drug development.
Formula:C6H7BO3S
InChI:InChI=1S/C6H7BO3S/c1-4(8)5-2-3-11-6(5)7(9)10/h2-3,9-10H,1H3
InChI key:InChIKey=PQADNZSQUZLYFB-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C(C)=O)C=CS1
Synonyms:- Boronic acid, (3-acetyl-2-thienyl)-
- (3-Acetylthiophen-2-yl)boronic acid
- 3-Acetyl-2-thiopheneboronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
