
CAS 36155-79-0
:4-Bromo-2-propylthiophene
Description:
4-Bromo-2-propylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 4-position and a propyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits a yellow to brown color and is soluble in organic solvents. It is known for its potential applications in organic electronics, particularly in the development of conductive polymers and materials for organic light-emitting diodes (OLEDs). The bromine substituent can enhance the reactivity of the compound, making it useful in various chemical reactions, including cross-coupling reactions. Additionally, the propyl group can influence the compound's solubility and stability. As with many organobromine compounds, safety precautions should be taken due to potential toxicity and environmental concerns. Overall, 4-Bromo-2-propylthiophene is a significant compound in the field of organic chemistry and materials science.
Formula:C7H9BrS
InChI:InChI=1S/C7H9BrS/c1-2-3-7-4-6(8)5-9-7/h4-5H,2-3H2,1H3
InChI key:InChIKey=WUCPCORZZJWVHG-UHFFFAOYSA-N
SMILES:C(CC)C1=CC(Br)=CS1
Synonyms:- Thiophene, 4-bromo-2-propyl-
- 4-Bromo-2-propylthiophene
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery