CAS 36155-89-2

4-Chloro-3-thiophenecarboxaldehyde

Description:

4-Chloro-3-thiophenecarboxaldehyde is an organic compound characterized by the presence of a thiophene ring, a five-membered aromatic heterocycle containing sulfur, and an aldehyde functional group. The compound features a chlorine atom substituted at the 4-position of the thiophene ring and a carboxaldehyde group at the 3-position. This structure contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the electron-withdrawing chlorine atom can influence the compound's electrophilic and nucleophilic properties, making it useful in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the thiophene moiety can impart unique electronic properties, making it of interest in materials science and the development of organic semiconductors. 4-Chloro-3-thiophenecarboxaldehyde is typically handled with care due to its potential toxicity and reactivity, and it is important to follow appropriate safety protocols when working with this compound in a laboratory setting.

Formula: C₅H₃ClOS

InChI: InChI=1S/C5H3ClOS/c6-5-3-8-2-4(5)1-7/h1-3H

InChI key: InChIKey=MXDGWCVDBWFTMC-UHFFFAOYSA-N

SMILES: C(=O)C=1C(Cl)=CSC1

Synonyms:

• 3-Thiophenecarboxaldehyde, 4-chloro-
• 4-Chloro-3-thiophenecarboxaldehyde

4-Chloro-3-thiophenecarboxaldehyde

Controlled Product

CAS: 36155-89-2

Applications 4-Chloro-3-thiophenecarboxaldehyde, is a building block used in various chemical synthesis.

Formula: C₅H₃ClOS

Color and Shape: Neat

Molecular weight: 146.595

Ref: TR-C179100

4-Chlorothiophene-3-carbaldehyde

CAS: 36155-89-2

Versatile small molecule scaffold

Formula: C₅H₃ClOS

Purity: Min. 95%

Molecular weight: 146.6 g/mol

Ref: 3D-LBA15589