CAS 36160-82-4

4-(4-Fluorophenoxy)aniline

Description:

4-(4-Fluorophenoxy)aniline, with the CAS number 36160-82-4, is an organic compound characterized by the presence of both an aniline and a fluorophenyl group. It features a phenoxy group (–O–C6H4–F) attached to the para position of an aniline structure (–NH2). This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, enhancing its reactivity and solubility in various solvents. Additionally, the presence of the amino group (–NH2) contributes to its basicity and potential for forming hydrogen bonds, which can affect its interactions in biological systems. Safety data indicates that, like many aromatic amines, it should be handled with care due to potential toxicity and environmental concerns. Overall, 4-(4-Fluorophenoxy)aniline is a compound of interest in both industrial and research contexts.

Formula: C₁₂H₁₀FNO

InChI: InChI=1/C12H10FNO/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H,14H2

SMILES: c1cc(ccc1F)Oc1ccc(cc1)N

Synonyms:

• 4-(4-Fluorophenoxy)benzenamine

4-(4-Fluorophenoxy)aniline

CAS: 36160-82-4

Formula: C₁₂H₁₀FNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.2123

Ref: IN-DA003K3J

4-(4-Fluorophenoxy)aniline

CAS: 36160-82-4

4-(4-Fluorophenoxy)aniline

Formula: C₁₂H₁₀FNO

Purity: ≥95%

Color and Shape: beige crystalline powder

Molecular weight: 203.21g/mol

Ref: 54-PC9750

4-(4-Fluorophenoxy)aniline

CAS: 36160-82-4

Formula: C₁₂H₁₀FNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 203.216

Ref: 10-F240060