CymitQuimica logo

CAS 3619-71-4

:

Hexahydro-1-propyl-5H-1,4-diazepin-5-one

Description:
Hexahydro-1-propyl-5H-1,4-diazepin-5-one, with the CAS number 3619-71-4, is a cyclic organic compound characterized by its diazepine structure, which consists of a seven-membered ring containing two nitrogen atoms. This compound features a propyl group attached to the nitrogen atom, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the carbonyl group (ketone) in its structure suggests potential reactivity, particularly in nucleophilic addition reactions. Hexahydro-1-propyl-5H-1,4-diazepin-5-one may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of anxiolytic or sedative agents. Its solubility in organic solvents and limited solubility in water can influence its applications in various chemical processes. As with many nitrogen-containing heterocycles, it may also participate in coordination chemistry, forming complexes with metal ions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H16N2O
InChI:InChI=1S/C8H16N2O/c1-2-5-10-6-3-8(11)9-4-7-10/h2-7H2,1H3,(H,9,11)
InChI key:InChIKey=ADAAAIOFOANVSB-UHFFFAOYSA-N
SMILES:C(CC)N1CCC(=O)NCC1
Synonyms:
  • 1-Propyl-[1,4]diazepan-5-one
  • 5H-1,4-Diazepin-5-one, hexahydro-1-propyl-
  • Hexahydro-1-propyl-5H-1,4-diazepin-5-one
Found 0 products.