
CAS 36190-93-9
:Deacetyloleandrin
Description:
Deacetyloleandrin is a chemical compound classified as a flavonoid, specifically a type of glycoside derived from oleandrin, which is found in the Nerium oleander plant. This compound is characterized by its structural features, including a flavone backbone and sugar moieties that contribute to its biological activity. Deacetyloleandrin exhibits various pharmacological properties, including potential anti-inflammatory and anticancer effects, making it of interest in medicinal chemistry and pharmacology. Its mechanism of action may involve the modulation of signaling pathways and the inhibition of certain enzymes. Additionally, like many plant-derived compounds, it may possess antioxidant properties, which can help in mitigating oxidative stress. The compound's solubility, stability, and bioavailability are important factors that influence its therapeutic potential. As with many natural products, further research is necessary to fully understand its efficacy, safety, and potential applications in clinical settings.
Formula:C30H46O8
InChI:InChI=1S/C30H46O8/c1-16-27(33)23(35-4)13-25(37-16)38-19-7-9-28(2)18(12-19)5-6-21-20(28)8-10-29(3)26(17-11-24(32)36-15-17)22(31)14-30(21,29)34/h11,16,18-23,25-27,31,33-34H,5-10,12-15H2,1-4H3/t16-,18+,19-,20-,21+,22-,23-,25-,26-,27-,28-,29+,30-/m0/s1
InChI key:InChIKey=ROKXRURUBUVHBD-QSHOECCGSA-N
SMILES:C[C@@]12[C@@](O)([C@]3([C@](CC1)([C@]4(C)[C@](CC3)(C[C@@H](O[C@H]5C[C@H](OC)[C@@H](O)[C@H](C)O5)CC4)[H])[H])[H])C[C@H](O)[C@@H]2C=6COC(=O)C6
Synonyms:- Oleandrin, 16-deacetyl-
- 16-Deacetyloleandrin
- Card-20(22)-enolide, 3-[(2,6-dideoxy-3-O-methyl-L-arabino-hexopyranosyl)oxy]-14,16-dihydroxy-, (3β,5β,16β)-
- (3β,5β,16β)-3-[(2,6-Dideoxy-3-O-methyl-L-arabino-hexopyranosyl)oxy]-14,16-dihydroxycard-20(22)-enolide
- Oleandrin, deacetyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
16-Deacetyloleandrin
CAS:16-Deacetyloleandrin is a biochemical.Formula:C30H46O8Color and Shape:SolidMolecular weight:534.69
