CAS 36191-03-4

Pratensein-7-O-β-D-glucopyranoside

Description:

Pratensein-7-O-β-D-glucopyranoside is a flavonoid glycoside, primarily derived from various plant sources, particularly those in the Fabaceae family. This compound features a flavonoid backbone, specifically pratensein, which is glycosylated at the 7-position with a β-D-glucopyranoside moiety. The presence of the glucopyranoside group enhances its solubility in water and may influence its biological activity. Pratensein-7-O-β-D-glucopyranoside is known for its potential antioxidant properties, which can contribute to various health benefits, including anti-inflammatory effects. Additionally, it may exhibit antimicrobial and anticancer activities, although further research is needed to fully elucidate these effects. The compound is typically studied in the context of natural products chemistry and pharmacognosy, where it is evaluated for its therapeutic potential and mechanisms of action. Its CAS number, 36191-03-4, is a unique identifier that facilitates the cataloging and study of this specific chemical entity in scientific literature and databases.

Formula: C₂₂H₂₂O₁₁

InChI: InChI=1S/C22H22O11/c1-30-14-3-2-9(4-12(14)24)11-8-31-15-6-10(5-13(25)17(15)18(11)26)32-22-21(29)20(28)19(27)16(7-23)33-22/h2-6,8,16,19-25,27-29H,7H2,1H3/t16-,19-,20+,21-,22-/m1/s1

InChI key: InChIKey=FGAAKLDKKBMYCB-RECXWPGBSA-N

SMILES: O=C1C=2C(=CC(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=CC2O)OC=C1C4=CC(O)=C(OC)C=C4

Synonyms:

• Pratensein-7-O-β-D-glucopyranoside
• 4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-5-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-
• 7-(β-D-Glucopyranosyloxy)-5-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one
• Pratensein-7-O-β-D-glucoside
• Pratensein 7-O-glucoside

Pratensein-7-O-β-D-glucopyranoside

CAS: 36191-03-4

Pratensein 7-O-glucopyranoside is a natural product

Formula: C₂₂H₂₂O₁₁

Purity: 98%

Color and Shape: Solid

Molecular weight: 462.4

Ref: TM-TN2099

Pratensein 7-O-glucopyranoside

CAS: 36191-03-4

Formula: C₂₂H₂₂O₁₁

Purity: 95%~99%

Molecular weight: 462.407

Ref: BP-BP4902

Pratensein 7-O-glucoside

CAS: 36191-03-4

Pratensein 7-O-glucoside is a naturally occurring flavonoid glucoside, which is extracted from various plant sources such as red clover, Trifolium pratense. This compound is formed when the flavonoid pratensein is glycosylated at the 7th position with glucose. As a member of the isoflavone group, Pratensein 7-O-glucoside may exert its effects primarily through antioxidant mechanisms, neutralizing reactive oxygen species and reducing oxidative stress.

Formula: C₂₂H₂₂O₁₁

Purity: Min. 95%

Molecular weight: 462.4 g/mol

Ref: 3D-XP161636