CAS 36191-21-6

N~2~-(4-chlorobutyl)-N-(2,6-dimethylphenyl)-N~2~-methylglycinamide

Description:

N~2~-(4-chlorobutyl)-N-(2,6-dimethylphenyl)-N~2~-methylglycinamide, with CAS number 36191-21-6, is a chemical compound that belongs to the class of amides. It features a complex structure characterized by a methylglycinamide backbone, which is substituted with a 4-chlorobutyl group and a 2,6-dimethylphenyl group. This compound exhibits properties typical of amides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amide functional group. The chlorobutyl substituent may impart specific reactivity or biological activity, while the dimethylphenyl group can influence the compound's lipophilicity and steric properties. Such structural characteristics suggest potential applications in pharmaceuticals or agrochemicals, where modifications to the amide structure can lead to varied biological activities. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential uses in various fields.

Formula: C₁₅H₂₃ClN₂O

InChI: InChI=1/C15H23ClN2O/c1-12-7-6-8-13(2)15(12)17-14(19)11-18(3)10-5-4-9-16/h6-8H,4-5,9-11H2,1-3H3,(H,17,19)

SMILES: Cc1cccc(C)c1N=C(CN(C)CCCCCl)O

RAD-140-Q

CAS: 36191-21-6

RAD-140-Q: a selective androgen modulator that hinders growth in certain breast cancers and protects neurons.

Formula: C₁₅H₂₃ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 282.81

Ref: TM-T26037