CAS 361986-58-5

3-[(1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid

Description:

3-[(1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid, with the CAS number 361986-58-5, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a pyrazolo[3,4-d]pyrimidine derivative. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. It may display acidic characteristics due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of the pyrazolo[3,4-d]pyrimidine ring suggests potential biological activity, possibly as a kinase inhibitor or in other pharmacological applications. Its molecular structure may contribute to specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use, particularly in drug development or research applications.

Formula: C₁₃H₁₁N₅O₂

InChI: InChI=1/C13H11N5O2/c1-18-12-10(6-16-18)11(14-7-15-12)17-9-4-2-3-8(5-9)13(19)20/h2-7H,1H3,(H,19,20)(H,14,15,17)

SMILES: Cn1c2c(cn1)c(ncn2)Nc1cccc(c1)C(=O)O

3-[(1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid

CAS: 361986-58-5

Formula: C₁₃H₁₁N₅O₂

Molecular weight: 269.2587

Ref: IN-DA007B5J

3-[(1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid

CAS: 361986-58-5

Purity: 95.0%

Molecular weight: 269.2640075683594

Ref: 10-F314870