CAS 362-39-0
:1-{[(4R,7S,10S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-[(2S)-butan-2-yl]-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-isoleucylglycinamide
Description:
The chemical substance with the name "1-{[(4R,7S,10S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-[(2S)-butan-2-yl]-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-isoleucylglycinamide" and CAS number "362-39-0" is a complex peptide derivative characterized by its intricate structure, which includes multiple amino acid residues and functional groups. This compound features a cyclic framework containing sulfur and nitrogen atoms, indicative of its potential biological activity. The presence of various functional groups, such as amino, carbonyl, and hydroxyl, suggests that it may exhibit significant interactions with biological macromolecules, potentially influencing its pharmacological properties. The stereochemistry of the molecule, denoted by specific R and S configurations, is crucial for its biological activity and interaction with receptors or enzymes. Overall, this substance may be of interest in medicinal chemistry and pharmacology due to its structural complexity and potential therapeutic applications.
Formula:C43H66N12O12S2
InChI:InChI=1/C43H66N12O12S2/c1-5-21(3)34(41(65)48-18-33(47)59)54-40(64)30-8-7-15-55(30)43(67)29-20-69-68-19-25(44)36(60)50-27(16-23-9-11-24(56)12-10-23)39(63)53-35(22(4)6-2)42(66)49-26(13-14-31(45)57)37(61)51-28(17-32(46)58)38(62)52-29/h9-12,21-22,25-30,34-35,56H,5-8,13-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,65)(H,49,66)(H,50,60)(H,51,61)(H,52,62)(H,53,63)(H,54,64)/t21-,22-,25-,26-,27-,28-,29-,30-,34-,35?/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NCC(=N)O)O)N=C([C@@H]1CCCN1C(=O)[C@@H]1CSSC[C@@H](C(=N[C@@H](Cc2ccc(cc2)O)C(=NC([C@@H](C)CC)C(=N[C@@H](CCC(=N)O)C(=N[C@@H](CC(=N)O)C(=N1)O)O)O)O)O)N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(Ile⁸)-Oxytocin
CAS:Mesotocin is an oxytocin analog produced in birds, reptiles, and amphibians as well as in most marsupials.Formula:C43H66N12O12S2Color and Shape:White LyophilisateMolecular weight:1007.2Mesotocin trifluroacetate
CAS:Mesotocin is a peptide hormone that has a role in the regulation of water permeability and estradiol benzoate. It also regulates the physiological functions of the brain and has been shown to be involved in congestive heart failure, as it causes an increase in blood pressure. Mesotocin is found at high levels in human serum, but its activity is dependent on the presence of other hormones such as estradiol benzoate. The biological properties of mesotocin are largely unknown, although it is known to have receptor activity. The effects of this hormone on the kidney have been studied using mesotocin trifluroacetate (MTFA) and monoclonal antibody (mAb). MTFA causes an increase in glomerular filtration rate (GFR), which may be due to its ability to inhibit angiotensin II-induced vasoconstriction and decrease vascular resistance.Formula:C43H66N12O12S2Purity:Min. 95%Molecular weight:1,007.19 g/mol

