CAS 362-42-5
:4-amino-1-[2,3-O-(1-methylethylidene)pentofuranosyl]pyrimidin-2(1H)-one
Description:
4-amino-1-[2,3-O-(1-methylethylidene)pentofuranosyl]pyrimidin-2(1H)-one, with the CAS number 362-42-5, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidinone core, which is characterized by a six-membered aromatic ring containing nitrogen atoms. The presence of an amino group at the 4-position enhances its potential for biological activity, making it of interest in medicinal chemistry. The furanosyl moiety, specifically the 2,3-O-(1-methylethylidene) modification, indicates that the compound has a sugar-like structure, which may influence its solubility and interaction with biological systems. The compound's structural complexity suggests potential applications in nucleoside analogs or as a building block in the synthesis of more complex molecules. Its unique functional groups may also impart specific reactivity or binding properties, making it a candidate for further research in pharmacology or biochemistry. Overall, this compound exemplifies the intersection of organic chemistry and biological applications.
Formula:C12H17N3O5
InChI:InChI=1/C12H17N3O5/c1-12(2)19-8-6(5-16)18-10(9(8)20-12)15-4-3-7(13)14-11(15)17/h3-4,6,8-10,16H,5H2,1-2H3,(H2,13,14,17)
SMILES:CC1(C)OC2C(CO)OC(C2O1)n1ccc(=N)nc1O
Synonyms:- 2',3'-Isopropylidenecytidine
- Cytidine, 2',3'-O-(1-methylethylidene)-
- Molnupiravir Impurity 9
- 4-amino-1-[2,3-O-(1-methylethylidene)pentofuranosyl]pyrimidin-2(1H)-one
- 2',3'-O-isopropylidene cytidine
- 4-amino-1-[2,3-O-(1-methylethylidene)pentofuranosyl]pyrimidi...
- O2',O3'-isopropylidene-cytidine
- β-D-2',3'-O-(isopropylidene)cytidine
- 4-amino-1-[6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidin-2-one
- 2',3'-O-(1-Methylethylidene)cytidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2',3'-O-isopropylidene cytidine
CAS:Formula:C12H17N3O5Purity:95%Color and Shape:SolidMolecular weight:283.28052',3'-Isopropylidenecytidine
CAS:Controlled ProductApplications 2',3'-Isopropylidenecytidine is an intermediate in synthesizing 5-Hydroxymethylcytidine-13CD2 (H947092), an analogue of 5-Hydroxymethylcytidine (H947090) which is a product in DNA hydroxymethylation.
References Chouliaras, L., et. al.: NeuroBiol. Aging, 34, 2091 (2013)Formula:C12H17N3O5Color and Shape:NeatMolecular weight:283.282',3'-O-Isopropylidenecytidine
CAS:2',3'-O-Isopropylidenecytidine is a nucleoside for use in research applications
Formula:C12H17N3O5Purity:Min. 95%Color and Shape:PowderMolecular weight:283.28 g/mol







