CAS 362-75-4: 2',3'-O-Isopropylideneadenosine
Description:2',3'-O-Isopropylideneadenosine is a modified nucleoside that serves as a derivative of adenosine, characterized by the presence of an isopropylidene group at the 2' and 3' positions of the ribose sugar. This modification enhances the stability of the molecule, making it less susceptible to hydrolysis compared to unmodified nucleosides. The compound retains the purine base adenine, which is crucial for its biological activity. It is typically used in biochemical research and synthetic applications, particularly in the study of nucleic acid interactions and enzyme activity. The isopropylidene protection allows for selective reactions at other functional groups, facilitating further chemical modifications. In terms of solubility, it is generally soluble in polar organic solvents, which aids in its application in various laboratory settings. Overall, 2',3'-O-Isopropylideneadenosine is a valuable compound in the field of nucleoside chemistry, contributing to the understanding of nucleic acid structure and function.
Formula:C13H17N5O4
InChI:InChI=1S/C13H17N5O4/c1-13(2)21-8-6(3-19)20-12(9(8)22-13)18-5-17-7-10(14)15-4-16-11(7)18/h4-6,8-9,12,19H,3H2,1-2H3,(H2,14,15,16)/t6-,8-,9-,12-/m1/s1
InChI key:InChIKey=LCCLUOXEZAHUNS-WOUKDFQISA-N
SMILES:OCC1OC(N2C=NC=3C(=NC=NC32)N)C4OC(OC14)(C)C
- Synonyms:
- (2xi)-2',3'-O-(1-methylethylidene)adenosine
- (3xi)-2',3'-O-(1-methylethylidene)adenosine
- 2',3'-Isopropylideneadenosine
- 2',3'-O-(1-Methylethylidene)adenosine
- 2′,3′-Isopropylideneadenosine
- 2′,3′-O-(1-Methylethylidene)adenosine
- 2′,3′-O-Isopropylideneadenosine
- 9-[2,3-O-(1-methylethylidene)pentofuranosyl]-9H-purin-6-amine
- Adenosine, 2',3'-O-(1-methylethylidene)-
- Adenosine, 2',3'-O-(l-methylethylidene)-
- See more synonyms
- Adenosine, 2',3'-O-isopropylidene-
- Adenosine, 2′,3′-O-(1-methylethylidene)-
- Adenosine, 2′,3′-O-isopropylidene-
- Ai3-52661
- Furo[3,4-d]-1,3-dioxole, adenosine deriv.
- Nsc 29413
