CAS 362-76-5: 2′,3′-Isopropylideneguanosine
Description:2′,3′-Isopropylideneguanosine, with the CAS number 362-76-5, is a nucleoside analog derived from guanosine. It features a unique isopropylidene group at the 2′ and 3′ positions of the ribose sugar, which enhances its stability and resistance to enzymatic degradation. This modification allows it to serve as a useful tool in biochemical research and drug development. The compound exhibits properties typical of purine nucleosides, including the ability to participate in hydrogen bonding and base pairing, which is crucial for its role in nucleic acid interactions. Its structural modifications contribute to its potential as an antiviral agent and in studies related to RNA and DNA synthesis. Additionally, 2′,3′-Isopropylideneguanosine can influence cellular processes by mimicking natural nucleosides, making it valuable in the exploration of nucleic acid metabolism and signaling pathways. Overall, its unique characteristics make it a significant compound in the field of medicinal chemistry and molecular biology.
Formula:C13H17N5O5
InChI:InChI=1S/C13H17N5O5/c1-13(2)22-7-5(3-19)21-11(8(7)23-13)18-4-15-6-9(18)16-12(14)17-10(6)20/h4-5,7-8,11,19H,3H2,1-2H3,(H3,14,16,17,20)/t5-,7-,8-,11-/m1/s1
InChI key:InChIKey=XKPDAYWPKILAMO-IOSLPCCCSA-N
SMILES:O=C1N=C(N)NC2=C1N=CN2C3OC(CO)C4OC(OC34)(C)C
- Synonyms:
- 2',3'-Isopropylideneguanosine
- 2',3'-O-(1-methylethylidene)guanosine
- 2′,3′-Isopropylideneguanosine
- 2′,3′-O-(1-Methylethylidene)guanosine
- 2′,3′-O-Isopropylideneguanosine
- Furo[3,4-d]-1,3-dioxole, guanosine deriv.
- Guanosine, 2′,3′-O-(1-methylethylidene)-
- Guanosine, 2′,3′-O-isopropylidene-
- Isopropylideneguanosine
![2-Amino-9-((3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-1H…](https://static.cymitquimica.com/products/IN/thumb/DA007A7I.jpg)
![2-Amino-9-((3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-1H…](https://static.cymitquimica.com/products/10/thumb/F340076.jpg)
