CAS 362049-56-7: 1-Naphthalenyl-2,3,4,5,6,7,8-d7N-methylcarbamate
Description:1-Naphthalenyl-2,3,4,5,6,7,8-d7N-methylcarbamate is a chemical compound characterized by its unique structure, which includes a naphthalene ring and a carbamate functional group. The presence of deuterium atoms (d7) indicates that this compound is a deuterated derivative, which can be useful in various applications, including studies involving isotopic labeling. The naphthalene moiety contributes to the compound's aromatic properties, potentially influencing its solubility and reactivity. As a carbamate, it may exhibit biological activity, possibly acting as a pesticide or herbicide, depending on its specific interactions with biological systems. The compound's CAS number, 362049-56-7, allows for precise identification in chemical databases and literature. Overall, the characteristics of this compound suggest it may have applications in research and industry, particularly in fields related to organic chemistry and pharmacology. However, specific safety and handling guidelines should be consulted due to the potential toxicity associated with carbamate compounds.
Formula:C12H4D7NO2
InChI:InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14)/i2D,3D,4D,5D,6D,7D,8D
InChI key:InChIKey=CVXBEEMKQHEXEN-CFWCETGYSA-N
SMILES:O=C(OC1=CC=CC=2C=CC=CC12)NC
- Synonyms:
- (2,3,4,5,6,7,8-Heptadeuterionaphthalen-1-yl) N-methylcarbamate
- (< sup> 2< /sup> H< sub> 7< /sub> )-1-Naphthyl methylcarbamate
- 1-Naphthalen-2,3,4,5,6,7,8-d<sub>7</sub>-ol, 1-(N-methylcarbamate)
- 1-Naphthalen-2,3,4,5,6,7,8-d<sub>7</sub>-ol, methylcarbamate
- 1-Naphthalen-D< Sub> 7< /Sub> -Ol, Methylcarbamate
- 1-Naphthalenyl-2,3,4,5,6,7,8-d<sub>7</sub>N-methylcarbamate
- Carbaryl-d<sub>7</sub>
- 1-Naphthalen-2,3,4,5,6,7,8-d7-ol, methylcarbamate
- 1-Naphthalenyl-2,3,4,5,6,7,8-d7N-methylcarbamate
- Carbaryl-d7
- See more synonyms
- 1-Naphthalen-2,3,4,5,6,7,8-d7-ol, 1-(N-methylcarbamate)
