CAS 362049-57-8

Benzene-1,2,3,4-d4, 5-chloro-6-methyl-

Description:

Benzene-1,2,3,4-d4, 5-chloro-6-methyl- is a chlorinated aromatic compound characterized by its benzene ring structure, which is substituted with a chlorine atom and a methyl group, along with deuterium isotopes at specific positions on the ring. The presence of deuterium (d4) indicates that four hydrogen atoms in the benzene ring have been replaced with deuterium, a heavier isotope of hydrogen, which can influence the compound's physical and chemical properties, such as its reactivity and stability. The chlorine substituent typically introduces electrophilic characteristics, making the compound reactive in various chemical reactions, while the methyl group can affect the steric and electronic properties of the molecule. This compound is likely to be used in research applications, particularly in studies involving isotopic labeling or in the synthesis of more complex organic molecules. Its CAS number, 362049-57-8, allows for easy identification and retrieval of information regarding its properties and safety data.

Formula: C₇H₃ClD₄

InChI: InChI=1S/C7H7Cl/c1-6-4-2-3-5-7(6)8/h2-5H,1H3/i2D,3D,4D,5D

InChI key: InChIKey=IBSQPLPBRSHTTG-QFFDRWTDSA-N

SMILES: CC1=C(Cl)C(=C(C(=C1[2H])[2H])[2H])[2H]

Synonyms:

• 2-Chlorotoluene-3,4,5,6-D4
• Benzene-1,2,3,4-d₄, 5-chloro-6-methyl-
• Benzene-1,2,3,4-d4, 5-chloro-6-methyl-

2-Chlorotoluene-3,4,5,6-d4

CAS: 362049-57-8

Formula: ClC₆D₄CH₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 130.04873

Ref: 3U-D5470

2-Chlorotoluene-3,4,5,6-d4

Controlled Product

CAS: 362049-57-8

Applications 2-Chlorotoluene-3,4,5,6-d4 (CAS# 362049-57-8) is a useful isotopically labeled research compound.

Formula: C₇H₃D₄Cl

Color and Shape: Neat

Molecular weight: 130.61

Ref: TR-C382464