CAS 36207-49-5

2-Amino-N-hydroxypentanamide

Description:

2-Amino-N-hydroxypentanamide, with the CAS number 36207-49-5, is an organic compound characterized by the presence of an amino group (-NH2) and a hydroxylamine group (-NHOH) attached to a pentanamide backbone. This compound typically exhibits properties associated with both amines and amides, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in water and other solvents. The presence of the amino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the hydroxylamine functionality can engage in redox reactions, making it a potential candidate for various synthetic applications in organic chemistry. Its structural features may also impart biological activity, which could be of interest in pharmaceutical research. Overall, 2-Amino-N-hydroxypentanamide is a versatile compound with potential applications in both chemical synthesis and biological contexts.

Formula: C₅H₁₂N₂O₂

InChI: InChI=1S/C5H12N2O2/c1-2-3-4(6)5(8)7-9/h4,9H,2-3,6H2,1H3,(H,7,8)

InChI key: InChIKey=YWQDCRINEFTEGQ-UHFFFAOYSA-N

SMILES: C(C(NO)=O)(CCC)N

Synonyms:

• Pentanamide, 2-amino-N-hydroxy-
• DL-Norvaline hydroxamate
• 2-Amino-N-hydroxypentanamide
• 2-Amino-N-hydroxyvaleramide
• Pentanamide, 2-amino-N-hydroxy-, (±)-

N-Hydroxy2-aminopentanimidic acid

CAS: 36207-49-5

N-Hydroxy2-aminopentanimidic acid is a metal complexing agent that forms a ligand with the metal ion. It has been shown to form complexes with zinc, copper, and nickel ions. The protonation of N-hydroxy2-aminopentanimidic acid leads to its formation constants. These are determined by potentiometric titrations and can be used to estimate the concentration of hydrogen ions in solution. This chemical has been shown to have potentiometric properties, which make it useful for determining the concentrations of hydroxo and metal ions in solution. The formation constants of N-hydroxy2-aminopentanimidic acid are also determined by complex formation techniques and can be used to estimate the concentration of ligands in solution.

Formula: C₅H₁₂N₂O₂

Purity: Min. 95%

Molecular weight: 132.16 g/mol

Ref: 3D-LBA20749