CAS 36209-49-1

4-amino-5-(4-methoxyphenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Amino-5-(4-methoxyphenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 36209-49-1, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of an amino group and a methoxyphenyl substituent suggests that it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The compound is typically characterized by its solubility in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Its structural features may allow for interactions with biological targets, potentially leading to applications in drug development. Overall, this compound exemplifies the diverse chemistry of triazoles and their derivatives in pharmaceutical research.

Formula: C₉H₁₀N₄OS

InChI: InChI=1/C9H10N4OS/c1-14-7-4-2-6(3-5-7)8-11-12-9(15)13(8)10/h2-5H,10H2,1H3,(H,12,15)

SMILES: COc1ccc(cc1)c1nnc(n1N)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-amino-5-(4-methoxyphenyl)-

4-AMINO-5-(4-METHOXY-PHENYL)-4H-[1,2,4]TRIAZOLE-3-THIOL

CAS: 36209-49-1

Formula: C₉H₁₀N₄OS

Purity: 97%

Molecular weight: 222.2669

Ref: IN-DA007AFR

4-Amino-3-mercapto-5-(4-methoxyphenyl)-4H-1,2,4-triazole

CAS: 36209-49-1

4-Amino-3-mercapto-5-(4-methoxyphenyl)-4H-1,2,4-triazole

Purity: ≥95%

Molecular weight: 222.27g/mol

Ref: 54-OR3265

4-Amino-5-(4-methoxy-phenyl)-4H-[1,2,4]triazole-3-thiol

CAS: 36209-49-1

Formula: C₉H₁₀N₄OS

Purity: 97%

Molecular weight: 222.27

Ref: 10-F345145