CAS 3621-81-6

2,5-Dichlorobenzooxazole

Description:

2,5-Dichlorobenzooxazole is a heterocyclic organic compound characterized by its fused benzene and oxazole rings, with chlorine substituents at the 2 and 5 positions of the benzene ring. This compound typically appears as a solid and is known for its aromatic properties, which contribute to its stability and reactivity. It has a molecular formula that reflects the presence of chlorine atoms, which can influence its chemical behavior, including its reactivity and solubility in various solvents. 2,5-Dichlorobenzooxazole is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other chemical species. Additionally, safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, 2,5-Dichlorobenzooxazole is a significant compound in the field of organic chemistry with various applications.

Formula: C₇H₃Cl₂NO

InChI: InChI=1/C7H3Cl2NO/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H

SMILES: c1cc2c(cc1Cl)nc(Cl)o2

Synonyms:

• 2,5-Dichloro-1,3-benzoxazole
• Benzoxazole, 2,5-dichloro-
• 2,5-Dichlorobenzo[D]Oxazole

2,5-Dichlorobenzooxazole

CAS: 3621-81-6

Formula: C₇H₃Cl₂NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.0108

Ref: IN-DA0037YA

2,5-Dichloro-1,3-benzoxazole

CAS: 3621-81-6

2,5-Dichloro-1,3-benzoxazole

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.01g/mol

Ref: 54-OR40570

Suvorexant Impurity 2

CAS: 3621-81-6

Formula: C₇H₃Cl₂NO

Molecular weight: 188.01

Ref: ST-EA-CP-S43006

2,5-Dichlorobenzooxazole

CAS: 3621-81-6

Formula: C₇H₃Cl₂NO

Purity: 98%

Color and Shape: Solid, White powder

Molecular weight: 188.01

Ref: 10-F076787