CAS 36216-80-5

3-aminoisoxazole

Description:

3-Aminoisoxazole is a heterocyclic organic compound characterized by a five-membered ring containing both nitrogen and oxygen atoms. Specifically, it features an isoxazole ring, which consists of three carbon atoms, one nitrogen atom, and one oxygen atom, with an amino group (-NH2) attached to the carbon at the 3-position. This compound is typically a white to off-white solid and is soluble in polar solvents. 3-Aminoisoxazole is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its structure allows for various chemical modifications, which can enhance its pharmacological profile. The compound's reactivity is influenced by the presence of the amino group, which can participate in hydrogen bonding and nucleophilic reactions. Overall, 3-aminoisoxazole serves as a valuable scaffold in drug discovery and development, contributing to the synthesis of various bioactive molecules.

Formula: C₇H₆N₂O

InChI: InChI=1/C7H6N2O/c8-7-5-3-1-2-4-6(5)10-9-7/h1-4H,(H2,8,9)

SMILES: c1ccc2c(c1)c(=N)[nH]o2

Synonyms:

• 3-Amino Isoxazole
• 1,2-Oxazol-3-Amine
• 1,2-Benzisoxazol-3-Amine

Benzo[d]isoxazol-3-amine

CAS: 36216-80-5

Formula: C₇H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 134.1353

Ref: IN-DA007AFN

3-Amino-1,2-benzisoxazole

CAS: 36216-80-5

3-Amino-1,2-benzisoxazole

Formula: C₇H₆N₂O

Purity: 98%

Color and Shape: white to off-white solid

Molecular weight: 134.14g/mol

Ref: 54-OR25956

1,2-Benzisoxazol-3-amine

CAS: 36216-80-5

Formula: C₇H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 134.138

Ref: 10-F042828

1,2-Benzisoxazol-3-amine

Controlled Product

CAS: 36216-80-5

Applications 1,2-benzisoxazol-3-amine (cas# 36216-80-5) is a useful research chemical.

Formula: C₇H₆N₂O

Color and Shape: Neat

Molecular weight: 134.13

Ref: TR-B535183