CAS 3622-35-3
:6-Benzothiazolecarboxylic acid
Description:
6-Benzothiazolecarboxylic acid, with the CAS number 3622-35-3, is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound typically appears as a white to off-white crystalline solid. It is known for its acidic properties due to the presence of the carboxylic acid functional group (-COOH), which can participate in various chemical reactions, including esterification and amidation. The compound is soluble in polar solvents, such as water and alcohols, but may have limited solubility in non-polar solvents. 6-Benzothiazolecarboxylic acid is often utilized in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H5NO2S
InChI:InChI=1S/C8H5NO2S/c10-8(11)5-1-2-6-7(3-5)12-4-9-6/h1-4H,(H,10,11)
InChI key:InChIKey=DMPZJACLHDWUFS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(=CC1)N=CS2
Synonyms:- 1,3-Benzothiazole-6-Carboxylic Acid
- 6-Benzothiazolecarboxylic acid
- Benzo[D]Thiazole-6-Carboxylic Acid
- 1: PN: WO2008156676 SEQID: 1 claimed sequence
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Benzothiazole-6-carboxylic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H5NO2SPurity:96%Color and Shape:White to cream, PowderMolecular weight:179.2Benzothiazole-6-carboxylic acid
CAS:Formula:C8H5NO2SPurity:98%Color and Shape:SolidMolecular weight:179.1958Benzothiazole-6-carboxylic acid
CAS:Benzothiazole-6-carboxylic acidPurity:≥98%Molecular weight:179.196g/mol1,3-Benzothiazole-6-carboxylic acid
CAS:1,3-Benzothiazole-6-carboxylic acidFormula:C8H5NO2SPurity:techColor and Shape: off white powderMolecular weight:179.20g/molBenzothiazole-6-carboxylic acid
CAS:Benzothiazole-6-carboxylic acid is a molecular block that has the potential to inhibit the formation of urinary tract pathogenic E.coli K1 capsules.
Formula:C8H5NO2SPurity:99.72%Color and Shape:White To Light Yellow Crystal PowderMolecular weight:179.196Benzothiazole-6-carboxylic acid
CAS:Formula:C8H5NO2SPurity:96%Color and Shape:SolidMolecular weight:179.19





