CAS 3622-38-6

Benzothiazole, 2-chloro-5-nitro-

Description:

Benzothiazole, 2-chloro-5-nitro- is an organic compound characterized by its fused benzene and thiazole rings, which contribute to its aromatic properties. The presence of a chlorine atom at the 2-position and a nitro group at the 5-position on the benzothiazole structure significantly influences its chemical reactivity and physical properties. This compound typically appears as a yellow to brown solid and is known for its moderate solubility in organic solvents. It exhibits properties such as being a potential intermediate in organic synthesis and may have applications in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, the nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution. Safety data indicates that it should be handled with care due to potential toxicity and environmental hazards. Overall, benzothiazole, 2-chloro-5-nitro- is a versatile compound with notable significance in chemical research and industrial applications.

Formula: C₇H₃ClN₂O₂S

InChI: InChI=1/C7H3ClN2O2S/c8-7-9-5-3-4(10(11)12)1-2-6(5)13-7/h1-3H

SMILES: c1cc2c(cc1N(=O)=O)nc(Cl)s2

Synonyms:

• 2-Chloro-5-nitro-1,3-benzothiazole
• benzothiazole, 2-chloro-5-nitro-

2-Chloro-5-nitrobenzo[d]thiazole

CAS: 3622-38-6

Formula: C₇H₃ClN₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.6289

Ref: IN-DA00338H

2-Chloro-5-nitrobenzothiazole

CAS: 3622-38-6

2-Chloro-5-nitrobenzothiazole

Purity: 98%

Molecular weight: 214.63g/mol

Ref: 54-OR300700

2-Chloro-5-nitro-1,3-benzothiazole

CAS: 3622-38-6

Formula: C₇H₃ClN₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.62

Ref: 10-F068805