CAS 3623-23-2

1-bromo-4-nitrosobenzene

Description:

1-Bromo-4-nitrosobenzene is an organic compound characterized by the presence of both a bromine atom and a nitroso group (-NO) attached to a benzene ring. The bromine substituent is located at the para position relative to the nitroso group, which influences the compound's reactivity and properties. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. It exhibits moderate stability under standard conditions but may undergo reactions such as electrophilic substitution due to the electron-withdrawing nature of the nitroso group. Additionally, 1-bromo-4-nitrosobenzene can be sensitive to light and may require careful handling to prevent degradation. Its solubility in organic solvents makes it useful in various chemical reactions, while its unique functional groups contribute to its reactivity profile. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₆H₄BrNO

InChI: InChI=1/C6H4BrNO/c7-5-1-3-6(8-9)4-2-5/h1-4H

SMILES: c1cc(ccc1Br)N=O

Synonyms:

• Benzene, 1-Bromo-4-Nitroso-
• 1-Bromo-4-nitrosobenzene

1-Bromo-4-nitrosobenzene

CAS: 3623-23-2

Formula: C₆H₄BrNO

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 186.01

Ref: 3B-B6644

1-Bromo-4-nitrosobenzene

CAS: 3623-23-2

1-Bromo-4-nitrosobenzene is a chemical compound that has been shown to be a stable, metastable molecule. It can undergo nucleophilic attack on the carbonyl group by deuterium atoms. This reaction is dependent on kinetic and thermodynamic factors, such as activation energy and the concentration of the reactants. The FT-IR spectroscopy for this compound reveals that it consists of two heterodimers: one containing three nitroso groups and one bromine atom and another with two nitroso groups and one bromine atom. The rates of reaction for these monomers are different because they are not equivalent in terms of their chemical properties.

Formula: C₆H₄BrNO

Purity: Min. 95%

Molecular weight: 186.01 g/mol

Ref: 3D-DAA62323