CAS 36233-82-6

2-ethyltetrahydro-4H-pyran-4-one

Description:

2-Ethyltetrahydro-4H-pyran-4-one, with the CAS number 36233-82-6, is a cyclic compound characterized by its pyranone structure, which features a six-membered ring containing both oxygen and carbon atoms. This compound typically exhibits a colorless to pale yellow liquid form and has a distinctive sweet, fruity odor, often associated with certain flavoring agents. Its molecular structure includes an ethyl group attached to the tetrahydro-pyran ring, contributing to its unique chemical properties. The compound is known for its potential applications in the food and fragrance industries due to its pleasant aroma. Additionally, it may exhibit solubility in organic solvents, making it useful in various chemical syntheses and formulations. The presence of the carbonyl group in the pyranone structure can also impart reactivity, allowing for further chemical modifications. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₇H₁₂O₂

InChI: InChI=1/C7H12O2/c1-2-7-5-6(8)3-4-9-7/h7H,2-5H2,1H3

SMILES: CCC1CC(=O)CCO1

Synonyms:

• 4H-pyran-4-one, 2-ethyltetrahydro-

2-ethyloxan-4-one

CAS: 36233-82-6

Formula: C₇H₁₂O₂

Purity: 92%

Molecular weight: 128.1690

Ref: IN-DA00D2LJ

2-Ethyltetrahydro-4H-pyran-4-one

CAS: 36233-82-6

Versatile small molecule scaffold

Formula: C₇H₁₂O₂

Purity: Min. 95%

Molecular weight: 128.16 g/mol

Ref: 3D-LBA23382