CAS 36236-73-4

4-(Chloromethyl)-2-methyl-2-pentyl-1,3-dioxolane

Description:

4-(Chloromethyl)-2-methyl-2-pentyl-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which features a chloromethyl group and a branched alkyl chain. The presence of the chloromethyl group indicates that it can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. The dioxolane moiety contributes to the compound's stability and solubility in various organic solvents. This compound may exhibit moderate polarity due to the presence of the dioxolane ring, which can influence its reactivity and interactions with other chemical species. Additionally, the branched pentyl group can affect the compound's physical properties, such as boiling point and viscosity. As with many chlorinated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Overall, 4-(Chloromethyl)-2-methyl-2-pentyl-1,3-dioxolane serves as a useful building block in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₉ClO₂

InChI: InChI=1S/C10H19ClO2/c1-3-4-5-6-10(2)12-8-9(7-11)13-10/h9H,3-8H2,1-2H3

InChI key: InChIKey=HFNJYHPLTFGNLJ-UHFFFAOYSA-N

SMILES: C(CCCC)C1(C)OC(CCl)CO1

Synonyms:

• AY 22352
• NSC 44539
• 4-(Chloromethyl)-2-methyl-2-pentyl-1,3-dioxolane
• 1,3-Dioxolane, 4-(chloromethyl)-2-methyl-2-pentyl-

AY 22352

CAS: 36236-73-4

AY 22352 is a biochemical.

Formula: C₁₀H₁₉ClO₂

Color and Shape: Solid

Molecular weight: 206.71

Ref: TM-T30241