CymitQuimica logo

CAS 36239-69-7

:

1,3-Dihydro-1,3-dioxo-2H-pyrrolo[3,4-c]pyridine-2-acetic acid

Description:
1,3-Dihydro-1,3-dioxo-2H-pyrrolo[3,4-c]pyridine-2-acetic acid, with CAS number 36239-69-7, is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure. This compound features a pyrrole ring fused to a pyridine ring, along with two carbonyl groups (dioxo) and an acetic acid moiety. The presence of these functional groups contributes to its potential reactivity and biological activity. Typically, compounds of this nature may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects can vary. The dioxo groups suggest potential for chelation with metal ions, which can influence its chemical behavior and applications in coordination chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the acetic acid group, which may also affect its interaction with biological systems. Overall, 1,3-Dihydro-1,3-dioxo-2H-pyrrolo[3,4-c]pyridine-2-acetic acid represents a class of compounds with diverse potential applications in medicinal chemistry and materials science.
Formula:C9H6N2O4
InChI:InChI=1S/C9H6N2O4/c12-7(13)4-11-8(14)5-1-2-10-3-6(5)9(11)15/h1-3H,4H2,(H,12,13)
InChI key:InChIKey=DPYUWQXDKQQQRE-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CC(O)=O)=CN=CC2
Synonyms:
  • 1,3-Dihydro-1,3-dioxo-2H-pyrrolo[3,4-c]pyridine-2-acetic acid
  • 2-[1,3-Dioxo-1H,2H,3H-pyrrolo[3,4-c]pyridin-2-yl]acetic acid
  • 2H-Pyrrolo[3,4-c]pyridine-2-acetic acid, 1,3-dihydro-1,3-dioxo-
  • 2-(1,3-Dioxopyrrolo[3,4-c]pyridin-2-yl)acetic acid
  • (1,3-Dioxo-1,3-dihydro-2H-pyrrolo[3,4-c]pyridin-2-yl)acetic acid
Found 0 products.