
CAS 3624-87-1
:Metabutoxycaine
Description:
Metabutoxycaine, with the CAS number 3624-87-1, is a chemical compound that belongs to the class of local anesthetics. It is characterized by its ability to block nerve conduction, providing temporary loss of sensation in targeted areas. The compound features a butoxy group, which contributes to its lipophilicity, enhancing its ability to penetrate biological membranes. Metabutoxycaine is typically used in medical applications for its anesthetic properties, often in procedures requiring localized pain relief. Its mechanism of action involves the inhibition of sodium ion influx through voltage-gated sodium channels in neuronal membranes, thereby preventing the generation and propagation of action potentials. While specific pharmacokinetic and pharmacodynamic properties may vary, local anesthetics like metabutoxycaine are generally known for their rapid onset and relatively short duration of action. Safety and efficacy profiles are essential considerations in its use, and potential side effects may include allergic reactions or systemic toxicity if administered improperly. As with all medications, it is crucial to use metabutoxycaine under appropriate medical supervision.
Formula:C17H28N2O3
InChI:InChI=1S/C17H28N2O3/c1-4-7-12-21-16-14(9-8-10-15(16)18)17(20)22-13-11-19(5-2)6-3/h8-10H,4-7,11-13,18H2,1-3H3
InChI key:InChIKey=LJQWYEFHNLTPBZ-UHFFFAOYSA-N
SMILES:C(OCCN(CC)CC)(=O)C1=C(OCCCC)C(N)=CC=C1
Synonyms:- Ethanol, 2-diethylamino-, 3-amino-2-butoxybenzoate
- Benzoic acid, 3-amino-2-butoxy-, 2-(diethylamino)ethyl ester
- 2-(Diethylamino)ethyl 3-amino-2-butoxybenzoate
- Metabutoxycaine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Metabutoxycaine
CAS:Metabutoxycaine, a local anesthetic [1], serves to numb specific areas of the body.Formula:C17H28N2O3Color and Shape:SolidMolecular weight:308.42
