CymitQuimica logo

CAS 36242-50-9

:

Methyl 4-(methylamino)-3-nitrobenzoate

Description:
Methyl 4-(methylamino)-3-nitrobenzoate, with the CAS number 36242-50-9, is an organic compound characterized by its ester functional group and the presence of both a nitro and a methylamino group on the aromatic ring. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its non-polar characteristics due to the aromatic structure. The nitro group contributes to its potential reactivity, making it a candidate for various chemical transformations. The methylamino group can participate in hydrogen bonding, influencing its solubility and reactivity. Methyl 4-(methylamino)-3-nitrobenzoate may be used in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that can undergo further reactions. Safety data should be consulted for handling, as compounds with nitro groups can pose risks related to toxicity and environmental impact. Overall, this compound exemplifies the complexity and utility of substituted benzoate esters in chemical synthesis.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c1-10-7-4-3-6(9(12)15-2)5-8(7)11(13)14/h3-5,10H,1-2H3
InChI key:RUJMPEWZLDVEAV-UHFFFAOYSA-N
SMILES:CNC1=C(C=C(C=C1)C(=O)OC)[N+](=O)[O-]
Found 4 products.