CAS 362529-02-0

[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanol

Description:

[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanol, with the CAS number 362529-02-0, is an organic compound characterized by its phenolic structure, which includes a hydroxymethyl group attached to a phenyl ring. The presence of a 1,2,4-oxadiazole moiety contributes to its unique chemical properties, including potential biological activity. This compound is likely to exhibit moderate solubility in polar solvents due to the hydroxyl group, while the oxadiazole ring may enhance its reactivity and interaction with biological targets. The methyl group on the oxadiazole can influence its electronic properties and steric hindrance, potentially affecting its pharmacological profile. Additionally, the compound may participate in hydrogen bonding due to the hydroxyl group, which can play a role in its interactions in various chemical environments. Overall, [4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanol is of interest in medicinal chemistry and material science for its potential applications.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1/C10H10N2O2/c1-7-11-10(14-12-7)9-4-2-8(6-13)3-5-9/h2-5,13H,6H2,1H3

SMILES: Cc1nc(c2ccc(cc2)CO)on1

[4-(3-Methyl-1,2,4-oxadiazol-5-yl)phenyl]methanol

CAS: 362529-02-0

[4-(3-Methyl-1,2,4-oxadiazol-5-yl)phenyl]methanol

Purity: ≥95%

Molecular weight: 190.20g/mol

Ref: 54-OR111384