CAS 3626-56-0
:2-(morpholin-4-yl)propanenitrile
Description:
2-(Morpholin-4-yl)propanenitrile, with the CAS number 3626-56-0, is an organic compound characterized by the presence of a morpholine ring and a nitrile functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It has a molecular structure that includes a propanenitrile backbone, which contributes to its reactivity and potential applications in organic synthesis. The morpholine moiety imparts unique properties, such as the ability to engage in hydrogen bonding and participate in various chemical reactions, making it useful in medicinal chemistry and as an intermediate in the synthesis of pharmaceuticals. The compound is generally soluble in polar solvents, which enhances its utility in various chemical processes. Safety data should be consulted for handling, as nitriles can be toxic and may pose health risks. Overall, 2-(morpholin-4-yl)propanenitrile is a versatile compound with significant relevance in chemical research and development.
Formula:C7H12N2O
InChI:InChI=1/C7H12N2O/c1-7(6-8)9-2-4-10-5-3-9/h7H,2-5H2,1H3
SMILES:CC(C#N)N1CCOCC1
Synonyms:- .beta.-(N-Morpholino)propanenitrile
- 4-Morpholineacetonitrile, Alpha-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(Morpholin-4-yl)propanenitrile
CAS:2-(Morpholin-4-yl)propanenitrile is a diaminodiphenylsulfone that inhibits the synthesis of pyrimidines, such as thymine and cytosine. It also has synergistic effects with sulphones, which are inhibitors of mycobacteria. The synergistic activity of 2-(Morpholin-4-yl)propanenitrile against mycobacteria has been shown to be due to its antimicrobial properties. This chemical compound has been shown to have a synergistic effect when combined with isoniazide, an inhibitor of the synthesis of mycolic acid in Mycobacterium tuberculosis.Formula:C7H12N2OPurity:Min. 95%Molecular weight:140.18 g/mol
