CAS 36261-61-7

met-asn

Description:

The chemical substance known as "met-asn," with the CAS number 36261-61-7, is a derivative of asparagine, an amino acid that plays a crucial role in protein synthesis and metabolism. Met-asn, or N-methyl-asparagine, features a methyl group attached to the nitrogen atom of the asparagine side chain, which can influence its biochemical properties and interactions. This modification can affect solubility, stability, and the ability to participate in hydrogen bonding, potentially altering its biological activity compared to its parent compound. Met-asn is often studied in the context of peptide synthesis and protein engineering, where such modifications can enhance the properties of peptides or proteins for therapeutic applications. Additionally, it may be utilized in various biochemical assays and research settings to investigate the role of amino acid modifications in cellular processes. As with many amino acid derivatives, its characteristics can be influenced by factors such as pH, temperature, and the presence of other molecules in the environment.

Formula: C₉H₁₇N₃O₄S

InChI: InChI=1/C9H17N3O4S/c1-17-3-2-5(10)8(14)12-6(9(15)16)4-7(11)13/h5-6H,2-4,10H2,1H3,(H2,11,13)(H,12,14)(H,15,16)

SMILES: CSCCC(C(=NC(CC(=N)O)C(=O)O)O)N

Synonyms:

• Methionylasparagine

H-Met-Asn-OH

CAS: 36261-61-7

Formula: C₉H₁₇N₃O₄S

Molecular weight: 263.3140

Ref: IN-DA019FRR

H-Met-Asn-Oh

Controlled Product

CAS: 36261-61-7

Formula: C₉H₁₇N₃O₄S

Color and Shape: Neat

Molecular weight: 263.314

Ref: TR-M225295

H-Met-Asn-OH

CAS: 36261-61-7

H-Met-Asn-OH is a peptide that is composed of the amino acids methionine, asparagine, and hydroxyproline. It has been found to be specific for influenza and has been proposed as a potential drug target for this virus. The constant and resonance energies of H-Met-Asn-OH have been determined by NMR spectroscopy. The amino acid composition of H-Met-Asn-OH is typical of many proteins. Structural isomers are molecules that differ only in their spatial arrangement but share the same chemical formula. H-Met-Asn-OH can be considered a structural isomer because it differs by its chirality, which means that it rotates plane polarized light in one direction while its mirror image, L-methionine asparagine hydroxyproline (LMAHP), rotates light in the opposite direction. Gene products are molecules that are responsible for converting information from DNA into proteins via

Formula: C₉H₁₇N₃O₄S

Purity: Min. 95%

Molecular weight: 263.32 g/mol

Ref: 3D-FM108121

H-Met-Asn-OH

CAS: 36261-61-7

Bachem ID: 4006671.

Formula: C₉H₁₇N₃O₄S

Purity: > 98%

Color and Shape: White Powder

Molecular weight: 263.32

Ref: 01-4006671