CAS 36265-54-0

1,2-bis(4-methoxyphenyl)ethanamine

Description:

1,2-bis(4-methoxyphenyl)ethanamine, with the CAS number 36265-54-0, is an organic compound characterized by its structure, which features two para-methoxyphenyl groups attached to a central ethanamine moiety. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in organic solvents, such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic aromatic groups. The presence of methoxy groups enhances its electron-donating properties, which can influence its reactivity and interactions with other chemical species. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its potential applications could include use as a building block in organic synthesis or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₆H₁₉NO₂

InChI: InChI=1/C16H19NO2/c1-18-14-7-3-12(4-8-14)11-16(17)13-5-9-15(19-2)10-6-13/h3-10,16H,11,17H2,1-2H3

1,2-Bis(4-methoxyphenyl)ethan-1-amine

CAS: 36265-54-0

1,2-Bis(4-methoxyphenyl)ethan-1-amine is an organic compound with the formula CH3C6H4(OCH2CH2)2NH. It is a colorless liquid that is soluble in water and polar organic solvents. The molecule consists of an ethanamine moiety substituted with two methoxyphenyl groups at the 1 and 2 positions. The molecule has been shown to react via a hydride transfer reaction with diborane to form a boronate ester, which can be hydrogenated back to the starting material. This process is catalyzed by acid or acid esters such as pyridine or triethylamine.

Formula: C₁₆H₁₉NO₂

Purity: Min. 95%

Molecular weight: 257.33 g/mol

Ref: 3D-LBA26554