CAS 36266-40-7
:1-(3,4,5-trimethoxyphenyl)ethanol
Description:
1-(3,4,5-trimethoxyphenyl)ethanol, identified by its CAS number 36266-40-7, is an organic compound characterized by the presence of a phenolic structure with three methoxy groups (-OCH3) attached to the aromatic ring and a hydroxyl group (-OH) linked to an ethyl chain. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its hydrophobic nature due to the methoxy substituents. The presence of the hydroxyl group contributes to its potential as a phenolic compound, which may exhibit antioxidant properties. The methoxy groups can influence the compound's reactivity and interaction with biological systems, potentially affecting its pharmacological activities. Additionally, the compound may be of interest in various fields, including medicinal chemistry and materials science, due to its structural features that could facilitate interactions with biological targets or serve as a precursor for further chemical modifications. Overall, 1-(3,4,5-trimethoxyphenyl)ethanol represents a versatile compound with potential applications in research and industry.
Formula:C11H16O4
InChI:InChI=1/C11H16O4/c1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3/h5-7,12H,1-4H3
SMILES:CC(c1cc(c(c(c1)OC)OC)OC)O
Synonyms:- Benzenemethanol, 3,4,5-Trimethoxy-Alpha-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(3,4,5-Trimethoxyphenyl)methyl carbinol
CAS:(3,4,5-Trimethoxyphenyl)methyl carbinol is a neuroprotective compound that belongs to the class of benzyl alcohols. It has been shown to have neuroprotective effects against daldinia-induced oxidative stress and biotoxicity. This compound has high electron transfer rates and can be used as an electron donor in enzymatic reactions. (3,4,5-Trimethoxyphenyl)methyl carbinol exhibits a high reactivity with alcohols and can be used in the synthesis of other compounds by transferring its alcohol group onto other molecules. The addition of deuterium atoms to this molecule has been shown to increase its reactivity with oxidants.
Formula:C11H16O4Purity:Min. 95%Color and Shape:LiquidMolecular weight:212.24 g/mol
