CAS 362665-56-3
:Pitolisant
Description:
Pitolisant, with the CAS number 362665-56-3, is a novel medication primarily used for the treatment of narcolepsy, a sleep disorder characterized by excessive daytime sleepiness and cataplexy. It functions as a selective histamine H3 receptor antagonist/inverse agonist, which enhances the release of histamine in the brain, promoting wakefulness and alertness. Pitolisant is known for its favorable side effect profile compared to traditional stimulants, as it does not exhibit the same potential for abuse or dependency. The substance is typically administered orally and has a relatively long half-life, allowing for once-daily dosing. Its chemical structure includes a pyridine ring, contributing to its pharmacological activity. Pitolisant has been shown to improve both subjective and objective measures of wakefulness in clinical studies, making it a significant advancement in the management of narcolepsy. As with any medication, it is essential to consider potential interactions and contraindications when prescribing or using Pitolisant.
Formula:C17H26ClNO
InChI:InChI=1S/C17H26ClNO/c18-17-9-7-16(8-10-17)6-4-14-20-15-5-13-19-11-2-1-3-12-19/h7-10H,1-6,11-15H2
InChI key:InChIKey=NNACHAUCXXVJSP-UHFFFAOYSA-N
SMILES:C(CCOCCCN1CCCCC1)C2=CC=C(Cl)C=C2
Synonyms:- 3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether
- Wakix
- Pitolisant
- 1-[3-[3-(4-Chlorophenyl)propoxy]propyl]piperidine
- Piperidine, 1-[3-[3-(4-chlorophenyl)propoxy]propyl]-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-[3-[3-(4-Chlorophenyl)propoxy]propyl]piperidine
CAS:Formula:C17H26ClNOPurity:95%Color and Shape:LiquidMolecular weight:295.8474Pitolisant
CAS:1-(3-(3-(4-Chlorophenyl)propoxy)propyl)piperidineFormula:C17H26ClNOPurity:98%Molecular weight:295.85Pitolisant
CAS:Pitolisant is a selective histamine H3 receptor inverse agonist, originating from chemical research into histaminergic pathways. It works by binding to histamine H3 receptors in the brain, functioning primarily as an antagonist/inverse agonist. This action leads to increased release of neurotransmitters such as histamine, acetylcholine, and norepinephrine, which play crucial roles in wakefulness and attention.
Formula:C17H26ClNOPurity:Min. 95%Color and Shape:PowderMolecular weight:295.85 g/molPitolisant
CAS:Pitolisant is a potent and selective nonimidazole inverse agonist that acts on the recombinant human histamine H3 receptor with Ki of 0.16 nM.Formula:C17H26ClNOPurity:99.95%Color and Shape:SolidMolecular weight:295.847Ref: TM-T60636
5mg46.00€1mL*10mM (DMSO)49.00€10mg66.00€25mg114.00€50mg178.00€100mg295.00€500mg708.00€







