CymitQuimica logo

CAS 36271-49-5

:

N-stearoyl cerebroside

Description:
N-stearoyl cerebroside, with the CAS number 36271-49-5, is a type of glycosphingolipid, specifically a ceramide derivative that features a stearoyl fatty acid chain. This compound is characterized by its hydrophobic ceramide backbone, which consists of a sphingosine base linked to a fatty acid, in this case, stearic acid. The hydrophilic portion includes a sugar moiety, typically a monosaccharide, which contributes to its amphiphilic nature. N-stearoyl cerebroside plays a significant role in cellular membranes, particularly in the central nervous system, where it is involved in cell signaling and membrane stability. It is also implicated in various biological processes, including cell recognition and differentiation. The compound is of interest in research related to neurobiology and potential therapeutic applications due to its structural properties and biological functions. Its solubility characteristics are influenced by the balance between its hydrophobic and hydrophilic regions, making it relevant in studies of lipid bilayers and membrane dynamics.
Formula:C42H81NO8
InChI:InChI=1/C42H81NO8/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-38(46)43-35(34-50-42-41(49)40(48)39(47)37(33-44)51-42)36(45)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h29,31,35-37,39-42,44-45,47-49H,3-28,30,32-34H2,1-2H3,(H,43,46)/b31-29+/t35-,36+,37?,39-,40-,41-,42+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • b-Galactosyl-C18-ceramide

    Controlled Product
    CAS:
    Formula:C42H81NO8
    Color and Shape:Neat
    Molecular weight:728.09

    Ref: TR-G184960

    5mg
    472.00€
    500µg
    67.00€