CAS 36289-13-1

2-(2-phenyl-1H-imidazo[1,2-a]benzimidazol-1-yl)ethanol

Description:

2-(2-phenyl-1H-imidazo[1,2-a]benzimidazol-1-yl)ethanol, with the CAS number 36289-13-1, is a chemical compound characterized by its complex structure, which includes an imidazo-benzimidazole core and an ethanol moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing ring structure. It may display solubility in organic solvents, and its behavior in aqueous environments can vary based on pH and other conditions. The presence of the phenyl group can influence its electronic properties and interactions with biological targets. Additionally, compounds of this nature are often investigated for their pharmacological potential, including antimicrobial or anticancer activities. The specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of organic molecules that are of interest in medicinal chemistry and material science.

Formula: C₁₇H₁₅N₃O

InChI: InChI=1/C17H15N3O/c21-11-10-19-16(13-6-2-1-3-7-13)12-20-15-9-5-4-8-14(15)18-17(19)20/h1-9,12,21H,10-11H2

SMILES: c1ccc(cc1)c1cn2c3ccccc3nc2n1CCO

Synonyms:

• 1H-Imidazo[1,2-a]benzimidazole-1-ethanol, 2-phenyl-
• 2-(2-Phenyl-1,3a,8-triaza-cyclopenta[a]inden-1-yl)-ethanol

2-(2-phenyl-1H-imidazo[1,2-a]benzimidazol-1-yl)ethanol

CAS: 36289-13-1

Purity: 95.0%

Molecular weight: 277.3269958496094

Ref: 10-F314382