CAS 36294-23-2

2,6-di-tert-butyl-4-(3-hydroxypropyl)phenol

Description:

2,6-Di-tert-butyl-4-(3-hydroxypropyl)phenol, commonly referred to as a phenolic antioxidant, is a chemical compound characterized by its bulky tert-butyl groups and a hydroxypropyl substituent. This structure enhances its stability and effectiveness as an antioxidant, making it useful in various applications, particularly in plastics and rubber, where it helps prevent oxidative degradation. The presence of the hydroxypropyl group contributes to its solubility in organic solvents and its ability to interact with other materials. This compound typically exhibits low volatility and high thermal stability, which are advantageous for industrial applications. Additionally, it is known for its ability to scavenge free radicals, thereby protecting materials from oxidative stress. Safety data indicates that while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed due to potential irritant properties. Overall, 2,6-di-tert-butyl-4-(3-hydroxypropyl)phenol is valued for its protective qualities in various formulations.

Formula: C₁₇H₂₈O₂

InChI: InChI=1/C17H28O2/c1-16(2,3)13-10-12(8-7-9-18)11-14(15(13)19)17(4,5)6/h10-11,18-19H,7-9H2,1-6H3

SMILES: CC(C)(C)c1cc(CCCO)cc(c1O)C(C)(C)C

Synonyms:

• 3-(3,5-Di-Tert-Butyl-4-Hydroxyphenyl)-1-Propanol
• Benzenepropanol, 3,5-Bis(1,1-Dimethylethyl)-4-Hydroxy-
• 2,6-Di-tert-butyl-4-(3-hydroxypropyl)phenol

2,6-Di-tert-butyl-4-(3-hydroxypropyl)phenol

CAS: 36294-23-2

2,6-Di-tert-butyl-4-(3-hydroxypropyl)phenol is a phthalic anhydride that is used in the manufacture of industrial products. 2,6-Di-tert-butyl-4-(3-hydroxypropyl)phenol is produced by the condensation of allyl alcohol and phthalic anhydride. This reaction is catalyzed by sulfuric acid and heat. The reaction can also be implemented using a solvent such as toluene.

Formula: C₁₇H₂₈O₂

Purity: Min. 95%

Molecular weight: 264.4 g/mol

Ref: 3D-LBA29423