CAS 36304-39-9
:(4-Methylphenoxy)acetic acid hydrazide
Description:
(4-Methylphenoxy)acetic acid hydrazide, with the CAS number 36304-39-9, is a chemical compound that belongs to the class of hydrazides. It is characterized by the presence of a hydrazide functional group (-CONHNH2) attached to a 4-methylphenoxyacetic acid moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both hydrophobic aromatic and hydrophilic functional groups. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal compounds. The compound's structure suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Additionally, it may undergo various chemical reactions typical of hydrazides, such as acylation or condensation reactions. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, (4-Methylphenoxy)acetic acid hydrazide is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-7-2-4-8(5-3-7)13-6-9(12)11-10/h2-5H,6,10H2,1H3,(H,11,12)
InChI key:InChIKey=BJAPYOSQJTZYQH-UHFFFAOYSA-N
SMILES:O(CC(NN)=O)C1=CC=C(C)C=C1
Synonyms:- (4-Methylphenoxy)acetic acid hydrazide
- (4-Methylphenoxy)acetyl hydrazide
- (4-Tolyloxy)acetic acid hydrazide
- 2-(4-Methylphenoxy)acethydrazide
- Acetic Acid, 2-(4-Methylphenoxy)-, Hydrazide
- Acetic acid, (4-methylphenoxy)-, hydrazide
- Acetic acid, (p-tolyloxy)-, hydrazide
- p-Cresoloxyacetyl hydrazine
- p-Methylphenoxyacetylhydrazine
- p-Tolyloxy-acetic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
