CAS 36304-40-2
:2-Chlorophenoxyacetic acid hydrazide
Description:
2-Chlorophenoxyacetic acid hydrazide, with the CAS number 36304-40-2, is a chemical compound that belongs to the class of hydrazides. It is characterized by the presence of a chlorophenoxy group, which contributes to its reactivity and potential applications in various fields, including agriculture and pharmaceuticals. This compound typically appears as a solid and is soluble in organic solvents. Its structure includes a hydrazide functional group, which is known for its ability to form hydrogen bonds, influencing its interactions with other molecules. 2-Chlorophenoxyacetic acid hydrazide may exhibit biological activity, making it of interest in the development of herbicides or other agrochemicals. Additionally, its chemical properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other substances. As with many chemical compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C8H9ClN2O2
InChI:InChI=1/C8H9ClN2O2/c9-6-3-1-2-4-7(6)13-5-8(12)11-10/h1-4H,5,10H2,(H,11,12)
SMILES:c1ccc(c(c1)Cl)OCC(=NN)O
Synonyms:- Asischem U30989
- Akos Bbb/158
- 2-Chlorophenoxyacetic acid hydrazide 98%
- 2-(2-Chlorophenoxy)Acetohydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Chlorophenoxyacetic acid hydrazide
CAS:Formula:C8H9ClN2O2Color and Shape:SolidMolecular weight:200.62232-Chlorophenoxyacetic acid hydrazide
CAS:2-Chlorophenoxyacetic acid hydrazideFormula:C8H9ClN2O2Purity:98%Color and Shape: solidMolecular weight:200.62g/mol2-(2-Chlorophenoxy)acetohydrazide
CAS:2-(2-Chlorophenoxy)acetohydrazide is a medicament that contains ligustilide, which is extracted from Schizochytrium limacinum using hydrochloric acid. It is a polyunsaturated compound that exhibits antioxidant activity. The CO2 extract of 2-(2-Chlorophenoxy)acetohydrazide contains various bioactive compounds such as 4-hydroxy-3,5-dimethoxybenzoic acid, protocatechuic acid, stachyose, and fatty acids. These compounds contribute to its antioxidant and redox potential properties. Additionally, 2-(2-Chlorophenoxy)acetohydrazide has been found to have phenolic acid content and exhibit anaerobic ammonium oxidation activity. This medicament can be used in the formulation of various medicines for different therapeutic purposes.Formula:C8H9ClN2O2Purity:Min. 95%Molecular weight:200.62 g/mol


