CAS 36304-47-9

2-(naphthalen-2-yloxy)acetohydrazide

Description:

2-(Naphthalen-2-yloxy)acetohydrazide is an organic compound characterized by its hydrazide functional group and a naphthalene moiety. This compound features a naphthalene ring substituted at the 2-position with an ether linkage to an acetohydrazide group. It typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents due to the hydrophobic nature of the naphthalene ring. The presence of the hydrazide functional group suggests potential reactivity, particularly in condensation reactions or as a ligand in coordination chemistry. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure allows for various intermolecular interactions, such as hydrogen bonding, which can influence its physical properties and reactivity. Overall, 2-(naphthalen-2-yloxy)acetohydrazide is a compound of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1/C12H12N2O2/c13-14-12(15)8-16-11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8,13H2,(H,14,15)

SMILES: c1ccc2cc(ccc2c1)OCC(=NN)O

Synonyms:

• 2-(2-Naphthyloxy)Acetohydrazide
• Acetic Acid, 2-(2-Naphthalenyloxy)-, Hydrazide