CAS 36324-02-4

2-amino-5-(2-hydroxyethyl)pyrimidin-4-ol

Description:

2-amino-5-(2-hydroxyethyl)pyrimidin-4-ol, with the CAS number 36324-02-4, is a pyrimidine derivative characterized by the presence of an amino group and a hydroxyethyl substituent. This compound features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The amino group at position 2 contributes to its basicity and potential for forming hydrogen bonds, while the hydroxyethyl group at position 5 enhances its solubility in polar solvents and may influence its biological activity. The hydroxyl group can participate in hydrogen bonding, making the compound potentially useful in various biochemical applications. This substance may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals, and it may also have implications in biological systems due to its structural similarity to nucleobases. Overall, its unique functional groups and heterocyclic structure contribute to its reactivity and potential applications in medicinal chemistry.

Formula: C₆H₉N₃O₂

InChI: InChI=1/C6H9N3O2/c7-6-8-3-4(1-2-10)5(11)9-6/h3,10H,1-2H2,(H3,7,8,9,11)

SMILES: C(CO)c1c[nH]c(=N)nc1O

Synonyms:

• 5-Pyrimidineethanol, 2-Amino-4-Hydroxy-