CAS 36326-86-0
:1-(4-sulfamoylphenyl)triaza-1,2-dien-2-ium
Description:
1-(4-Sulfamoylphenyl)triaza-1,2-dien-2-ium, identified by its CAS number 36326-86-0, is a chemical compound characterized by its unique triazine structure, which incorporates a sulfonamide functional group. This compound features a phenyl ring substituted with a sulfonamide group, contributing to its potential biological activity. The presence of the triazine moiety suggests that it may exhibit interesting electronic properties and reactivity, particularly in coordination chemistry or as a ligand in metal complexes. The sulfonamide group is known for its pharmacological significance, often associated with antibacterial and diuretic properties. The compound's ionic nature, indicated by the "dien-2-ium" designation, suggests it may exist in a protonated form, influencing its solubility and interaction with biological systems. Overall, this compound's structural features position it as a candidate for further investigation in medicinal chemistry and materials science, where its unique properties could be harnessed for various applications.
Formula:C6H7N4O2S
InChI:InChI=1/C6H7N4O2S/c7-10-9-5-1-3-6(4-2-5)13(8,11)12/h1-4,7H,(H2,8,11,12)/q+1
SMILES:C1=CC(C=CC1=NN=N)S(=N)(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Azidobenzenesulfonamide
CAS:Controlled ProductFormula:C6H6N4O2SColor and Shape:NeatMolecular weight:198.202
