CAS 36341-25-0

4-(1,3-benzothiazol-2-yl)-2-methoxyphenol

Description:

4-(1,3-benzothiazol-2-yl)-2-methoxyphenol, with the CAS number 36341-25-0, is an organic compound characterized by its complex structure that includes a benzothiazole moiety and a methoxyphenol group. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields, including pharmaceuticals and materials science. It may demonstrate biological activity, particularly in antimicrobial or antioxidant capacities, due to the presence of the phenolic group. The benzothiazole component can contribute to its stability and reactivity, making it a subject of interest in synthetic chemistry. Additionally, the compound's solubility and reactivity can vary based on the solvent and conditions used, which is crucial for its application in research and industry. Overall, 4-(1,3-benzothiazol-2-yl)-2-methoxyphenol represents a versatile chemical entity with potential utility in diverse chemical and biological contexts.

Formula: C₁₄H₁₁NO₂S

InChI: InChI=1/C14H11NO2S/c1-17-12-8-9(6-7-11(12)16)14-15-10-4-2-3-5-13(10)18-14/h2-8,16H,1H3

SMILES: COc1cc(ccc1O)c1nc2ccccc2s1

Synonyms:

• 4-Benzothiazol-2-yl-2-methoxy-phenol
• Phenol, 4-(2-Benzothiazolyl)-2-Methoxy-

4-(1,3-Benzothiazol-2-yl)-2-methoxyphenol

CAS: 36341-25-0

Formula: C₁₄H₁₁NO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 257.3076

Ref: IN-DA007A4C

YL-109

CAS: 36341-25-0

YL-109

Purity: ≥95%

Molecular weight: 257.31g/mol

Ref: 54-BUP12930

4-(Benzo[D]Thiazol-2-Yl)-2-Methoxyphenol

CAS: 36341-25-0

4-(Benzo[D]Thiazol-2-Yl)-2-Methoxyphenol

Purity: 98%

Molecular weight: 257.31g/mol

Ref: 54-OR1027784

YL-109

CAS: 36341-25-0

YL-109, a novel anticancer agent, can inhibit breast Y cell growth and invasiveness in vitro and in vivo.

Formula: C₁₄H₁₁NO₂S

Purity: 99.77% - ≥95%

Color and Shape: Solid

Molecular weight: 257.31

Ref: TM-T1960

4-(BENZO[D]THIAZOL-2-YL)-2-METHOXYPHENOL

CAS: 36341-25-0

Purity: 97.0%

Molecular weight: 257.30999755859375

Ref: 10-F301164