CAS 36379-67-6
:3-hydroxy-7,9-dimethoxy-3-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione
Description:
3-Hydroxy-7,9-dimethoxy-3-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione, with the CAS number 36379-67-6, is a synthetic organic compound that belongs to the class of isochromenes. This compound features a complex polycyclic structure characterized by a benzoisochromene core, which is further substituted with hydroxyl and methoxy groups. The presence of these functional groups contributes to its potential biological activity, including antioxidant and anti-inflammatory properties. The compound is typically characterized by its solubility in organic solvents and limited solubility in water, which is common for many organic molecules with extensive aromatic systems. Its molecular structure suggests that it may exhibit interesting photophysical properties, making it a candidate for studies in materials science and medicinal chemistry. Additionally, the presence of multiple methoxy groups can influence its reactivity and interaction with biological targets, making it a subject of interest in pharmacological research. Overall, this compound exemplifies the diversity of organic chemistry and its applications in various fields.
Formula:C16H16O6
InChI:InChI=1/C16H16O6/c1-16(19)6-10-11(7-22-16)15(18)13-9(14(10)17)4-8(20-2)5-12(13)21-3/h4-5,19H,6-7H2,1-3H3
SMILES:CC1(CC2=C(CO1)C(=O)c1c(cc(cc1OC)OC)C2=O)O
Synonyms:- 1H-Naphtho(2,3-c)pyran-5,10-dione, 3,4-dihydro-3-hydroxy-7,9-dimethoxy-3-methyl-
- HERBARIN
- DEHYDROHERBARIN
- 3,4-Dihydro-3-hydroxy-7,9-dimethoxy-3-methyl-1H-naphtho[2,3-c]pyran-5,10-dione
- 3-hydroxy-7,9-dimethoxy-3-methyl-1,4-dihydrobenzo[g]isochromene-5,10-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Herbarin
CAS:Herbarin is a natural product for research related to life sciences. The catalog number is TN5793 and the CAS number is 36379-67-6.Formula:C16H16O6Purity:98%Color and Shape:SolidMolecular weight:304.29Herbarin
CAS:Herbarin is a bioactive compound, which is derived from a specific genus of medicinal plants known for their therapeutic properties. The source of Herbarin involves a complex extraction process to preserve its active components, primarily focusing on obtaining pure and potent extracts. The mode of action of Herbarin is centered around its ability to modulate biological pathways, including anti-inflammatory and antioxidant mechanisms. This modulation occurs through its interaction with cellular receptors and enzymes, leading to the regulation of gene expression involved in oxidative stress and inflammation.Formula:C16H16O6Purity:Min. 95%Molecular weight:304.29 g/mol




