CymitQuimica logo

CAS 36397-23-6

:

3-(4-methoxyphenyl)propan-1-amine

Description:
3-(4-Methoxyphenyl)propan-1-amine, also known by its CAS number 36397-23-6, is an organic compound characterized by its amine functional group and a propyl chain attached to a para-methoxyphenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the methoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with biological systems. It may also exhibit moderate volatility and stability under standard conditions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Overall, 3-(4-methoxyphenyl)propan-1-amine is of interest for its chemical properties and potential applications in various fields, including drug development and chemical research.
Formula:C10H15NO
InChI:InChI=1/C10H15NO/c1-12-10-6-4-9(5-7-10)3-2-8-11/h4-7H,2-3,8,11H2,1H3
InChI key:NUZDQSUVPDNSSJ-UHFFFAOYSA-N
SMILES:COc1ccc(CCCN)cc1
Synonyms:
  • Benzenepropanamine, 4-Methoxy-
  • 4-Methoxy-benzenepropanamine
Found 4 products.