CAS 364-12-5

4-Bromo-1-iodo-2-(trifluoromethyl)benzene

Description:

4-Bromo-1-iodo-2-(trifluoromethyl)benzene is an aromatic compound characterized by the presence of a bromine atom, an iodine atom, and a trifluoromethyl group attached to a benzene ring. This compound features a complex substitution pattern, with the bromine and iodine atoms located at the para and ortho positions, respectively, relative to the trifluoromethyl group. The trifluoromethyl group (-CF3) is known for its strong electron-withdrawing properties, which can significantly influence the reactivity and stability of the compound. The presence of halogens (bromine and iodine) enhances the compound's potential for electrophilic aromatic substitution reactions. Additionally, the compound is likely to exhibit unique physical properties, such as a relatively high boiling point and low solubility in water, due to the presence of multiple halogen substituents. Its applications may include use in organic synthesis, pharmaceuticals, and materials science, where its specific electronic and steric properties can be advantageous. Safety precautions should be taken when handling this compound, as it may pose health and environmental risks.

Formula: C₇H₃BrF₃I

InChI: InChI=1S/C7H3BrF3I/c8-4-1-2-6(12)5(3-4)7(9,10)11/h1-3H

InChI key: InChIKey=FTIZUXGKTNJZEG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(I)C=CC(Br)=C1

Synonyms:

• 2-Trifluoromethyl-4-bromoiodobenzene
• 4-Bromo-1-iodo-2-(trifluoromethyl)benzene
• Benzene,4-bromo-1-iodo-2-(trifluoromethyl)-
• Toluene, 5-bromo-α,α,α-trifluoro-2-iodo-
• 5-Bromo-2-iodobenzotrifluoride

5-Bromo-2-iodobenzotrifluoride

CAS: 364-12-5

Formula: C₇H₃BrF₃I

Purity: 98%

Color and Shape: Solid

Molecular weight: 350.9024

Ref: IN-DA003MHE

5-Bromo-2-iodobenzotrifluoride

CAS: 364-12-5

5-Bromo-2-iodobenzotrifluoride

Formula: C₇H₃BrF₃I

Purity: 98%

Color and Shape: faint brown crystalline solid

Molecular weight: 350.90g/mol

Ref: 54-PC7413

5-Bromo-2-iodobenzotrifluoride

CAS: 364-12-5

Formula: C₇H₃BrF₃I

Purity: 97%

Color and Shape: Solid

Molecular weight: 350.905

Ref: 10-F013247