CAS 364-32-9
:2,6-dinitro-4-fluorophenol
Description:
2,6-Dinitro-4-fluorophenol, with the CAS number 364-32-9, is an organic compound characterized by its aromatic structure featuring both nitro and fluoro substituents. It is a yellow crystalline solid that is sparingly soluble in water but more soluble in organic solvents. The presence of two nitro groups at the 2 and 6 positions and a fluorine atom at the 4 position on the phenolic ring contributes to its chemical reactivity and potential applications. This compound is known for its acidic properties, as the hydroxyl group can donate a proton, making it a weak acid. Additionally, it exhibits strong electron-withdrawing effects due to the nitro and fluoro groups, which can influence its behavior in chemical reactions, particularly in electrophilic aromatic substitution. 2,6-Dinitro-4-fluorophenol is often used in research and industrial applications, including as a reagent in organic synthesis and as a potential intermediate in the production of various chemical compounds. Safety precautions should be taken when handling this substance due to its potential toxicity and environmental impact.
Formula:C6H2FN2O5
InChI:InChI=1/C6H3FN2O5/c7-3-1-4(8(11)12)6(10)5(2-3)9(13)14/h1-2,10H/p-1
SMILES:c1c(cc(c(c1N(=O)=O)[O-])N(=O)=O)F
Synonyms:- 4-Fluoro-2,6-dinitrophenol
- 4-Fluoro-2,6-Dinitrophenolate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Fluoro-2,6-dinitrophenol, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H3FN2O5Purity:98%Color and Shape:Powder, YellowMolecular weight:202.12,6-Dinitro-4-fluorophenol
CAS:2,6-Dinitro-4-fluorophenolFormula:C6H3FN2O5Purity:98%Color and Shape: yellow powderMolecular weight:202.10g/mol


