CAS 364-51-2
:ethyl 5-fluoro-2-nitrobenzoate
Description:
Ethyl 5-fluoro-2-nitrobenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a nitro group (-NO2) and a fluorine atom attached to the aromatic ring, specifically at the 2 and 5 positions, respectively. This compound typically appears as a yellow to light brown solid or liquid, depending on its purity and form. It is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water. Ethyl 5-fluoro-2-nitrobenzoate is often utilized in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals, due to its reactivity and the presence of both electron-withdrawing and electron-donating groups. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety.
Formula:C9H8FNO4
InChI:InChI=1/C9H8FNO4/c1-2-15-9(12)7-5-6(10)3-4-8(7)11(13)14/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1cc(ccc1N(=O)=O)F
Synonyms:- Benzoic Acid, 5-Fluoro-2-Nitro-, Ethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Fluoro-6-nitrobenzoic acid ethyl ester
CAS:3-Fluoro-6-nitrobenzoic acid ethyl ester is a high quality chemical that is used as an intermediate in the synthesis of complex compounds. It is also a useful scaffold for the synthesis of other compounds and can be used as a building block in the production of speciality chemicals. 3-Fluoro-6-nitrobenzoic acid ethyl ester has many reactions that it participates in, such as being a reaction component for the synthesis of pharmaceuticals and agrochemicals. This compound is versatile enough to be used in research or for commercial purposes.Formula:C9H8FNO4Purity:Min. 95%Color and Shape:PowderMolecular weight:213.16 g/mol


