CAS 364-73-8
:5-bromo-2-fluoronitrobenzene
Description:
5-Bromo-2-fluoronitrobenzene is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, and a nitro group attached to a benzene ring. Its molecular formula is C6H3BrFNO2, indicating that it contains six carbon atoms, three hydrogen atoms, one bromine atom, one fluorine atom, one nitrogen atom, and two oxygen atoms. This compound typically appears as a pale yellow to brown solid and is known for its moderate solubility in organic solvents. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity in electrophilic substitution reactions. Additionally, the halogen substituents (bromine and fluorine) can enhance the compound's utility in various chemical syntheses, including the development of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks, including toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.
Formula:C6H3BrFNO2
InChI:InChI=1/C6H3BrFNO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H
SMILES:c1cc(c(cc1Br)N(=O)=O)F
Synonyms:- 4-Bromo-1-Fluoro-2-Nitrobenzene
- 1-Bromo-4-Fluoro-3-Nitrobenzene
- 2-Fluoro-5-bromonitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Bromo-1-fluoro-2-nitrobenzene
CAS:Formula:C6H3BrFNO2Purity:>96.0%(GC)Color and Shape:Light yellow to Brown clear liquidMolecular weight:220.004-Bromo-1-fluoro-2-nitrobenzene, 98%
CAS:4-Bromo-1-fluoro-2-nitrobenzene is used in the synthesis of anti-inflammatory agents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / itemFormula:C6H3BrFNO2Purity:98%Color and Shape:Clear, yellow, liquidMolecular weight:220.005-Bromo-2-fluoronitrobenzene
CAS:Formula:C6H3BrFNO2Purity:98%Color and Shape:LiquidMolecular weight:219.99595-Bromo-2-fluoronitrobenzene
CAS:5-Bromo-2-fluoronitrobenzeneFormula:C6H3BrFNO2Purity:98%Color and Shape: clear. yellow to brown liquidMolecular weight:220.00g/mol1-Bromo-4-fluoro-3-nitrobenzene
CAS:Formula:C6H3BrFNO2Purity:97%Color and Shape:ClearMolecular weight:219.9974-Bromo-1-fluoro-2-nitrobenzene
CAS:4-Bromo-1-fluoro-2-nitrobenzene is a boron trifluoride compound that reacts with sulfuric acid to form the target product, 4-bromo-2-fluorobenzenesulfonic acid. It is used in the production of dyes and pharmaceuticals. The reaction is conducted at a temperature of 60°C in a reaction time of 8 hours. The repeatability of this process was found to be high, with a relative standard deviation (RSD) of 2.5% and an RSD for peak area of 3%. Experiments have been conducted to optimize the reaction conditions and determine the optimum reaction time and target product yield. A sulfuric acid concentration of 1M has been found to produce the highest yield, while maintaining the lowest RSD values.Formula:C6H3BrFNO2Purity:Min. 98%Molecular weight:220 g/mol





