CymitQuimica logo

CAS 364-96-5

:

2H-1,2,4-Benzothiadiazine, 6,7-dichloro-3-methyl-, 1,1-dioxide

Description:
2H-1,2,4-Benzothiadiazine, 6,7-dichloro-3-methyl-, 1,1-dioxide, commonly known as dichlorobenzothiadiazine, is a chemical compound characterized by its heterocyclic structure that includes a benzothiadiazine core. This compound features two chlorine atoms at the 6 and 7 positions and a methyl group at the 3 position, contributing to its unique chemical properties. The presence of the 1,1-dioxide functional group indicates that it has two oxygen atoms double-bonded to the sulfur atom in the thiadiazine ring, enhancing its reactivity and solubility in various solvents. It is often utilized in agricultural applications as a herbicide due to its ability to inhibit specific biochemical pathways in plants. The compound is typically stable under standard conditions but may undergo degradation when exposed to extreme pH or light. Safety data sheets indicate that it should be handled with care, as it may pose environmental and health risks if not managed properly. Overall, its distinctive structure and properties make it significant in both chemical research and practical applications.
Formula:C8H6Cl2N2O2S
InChI:InChI=1S/C8H6Cl2N2O2S/c1-4-11-7-2-5(9)6(10)3-8(7)15(13,14)12-4/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=NJMWRGDFOPSHPX-UHFFFAOYSA-N
SMILES:O=S1(=O)C=2C(=CC(Cl)=C(Cl)C2)NC(C)=N1
Synonyms:
  • 2H-1,2,4-Benzothiadiazine, 6,7-dichloro-3-methyl-, 1,1-dioxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.