CAS 36404-89-4

2-Hydroxynicotinaldehyde

Description:

2-Hydroxynicotinaldehyde, with the CAS number 36404-89-4, is an organic compound that belongs to the class of heterocyclic compounds, specifically derivatives of pyridine. It features a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to the pyridine ring, which contributes to its reactivity and potential applications in various chemical reactions. This compound is typically characterized by its ability to participate in condensation reactions, making it useful in the synthesis of more complex organic molecules. It exhibits moderate solubility in polar solvents due to the presence of the hydroxyl group, while its aromatic nature allows for π-π stacking interactions. 2-Hydroxynicotinaldehyde may also display biological activity, which has garnered interest in medicinal chemistry for potential applications in drug development. Its structural features enable it to act as a ligand in coordination chemistry, interacting with metal ions. Overall, 2-Hydroxynicotinaldehyde is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₆H₅NO₂

InChI: InChI=1/C6H5NO2/c8-4-5-2-1-3-7-6(5)9/h1-4H,(H,7,9)

SMILES: c1cc(C=O)c(nc1)O

Synonyms:

• 2-Hydroxypyridine-3-carboxaldehyde
• 2-Hydroxypyridine-3-Carbaldehyde

2-Oxo-1,2-dihydropyridine-3-carbaldehyde

CAS: 36404-89-4

Formula: C₆H₅NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 123.1094

Ref: IN-DA003HFS

2-Oxo-1,2-dihydropyridine-3-carbaldehyde

CAS: 36404-89-4

2-Oxo-1,2-dihydropyridine-3-carbaldehyde

Formula: C₆H₅NO₂

Purity: 97%

Color and Shape: pale yellow solid

Molecular weight: 123.11g/mol

Ref: 54-OR32598

2-Oxo-1,2-dihydro-3-pyridinecarbaldehyde

CAS: 36404-89-4

Formula: C₆H₅NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 123.111

Ref: 10-F044084